C28H37FN2 — CID 171839850
1-[(3E)-3-ethylidenehepta-1,4-dien-6-yn-2-yl]-N-[(2E,4E,5E)-4-(1-ethylprop-2-enylidene)-7-fluoro-5-methylocta-2,5,7-trien-2-yl]piperidin-4-amine (PubChem CID 171839850) has the molecular formula C28H37FN2 and a molecular weight of 420.62 g/mol. Its IUPAC name is 1-[(3E)-3-ethylidenehepta-1,4-dien-6-yn-2-yl]-N-[(2E,4E,5E)-4-(1-ethylprop-2-enylidene)-7-fluoro-5-methylocta-2,5,7-trien-2-yl]piperidin-4-amine.
| Compound Name | 1-[(3E)-3-ethylidenehepta-1,4-dien-6-yn-2-yl]-N-[(2E,4E,5E)-4-(1-ethylprop-2-enylidene)-7-fluoro-5-methylocta-2,5,7-trien-2-yl]piperidin-4-amine |
|---|---|
| PubChem CID | 171839850 |
| Molecular Formula | C28H37FN2 |
| Molecular Weight | 420.62 g/mol |
| Exact Mass | 420.29 |
| IUPAC Name | 1-[(3E)-3-ethylidenehepta-1,4-dien-6-yn-2-yl]-N-[(2E,4E,5E)-4-(1-ethylprop-2-enylidene)-7-fluoro-5-methylocta-2,5,7-trien-2-yl]piperidin-4-amine |
| SMILES | C#CC=C/C(=C\C)C(=C)N1CCC(N/C(C)=C/C(/C(C)=C/C(=C)F)=C(\C=C)CC)CC1 |
| InChI | InChI=1S/C28H37FN2/c1-9-13-14-26(12-4)24(8)31-17-15-27(16-18-31)30-23(7)20-28(25(10-2)11-3)21(5)19-22(6)29/h1,10,12-14,19-20,27,30H,2,6,8,11,15-18H2,3-5,7H3/b14-13?,21-19+,23-20+,26-12+,28-25- |
| InChIKey | DQHXQZHRXLWCBK-KWYIEFHESA-N |
| XLogP | 6.92 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.62 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|