C15H27FN2 — CID 143209317
N-[(Z,2E)-5-fluoro-2-propylidenehex-3-enyl]-1-methylpiperidin-4-amine (PubChem CID 143209317) has the molecular formula C15H27FN2 and a molecular weight of 254.39 g/mol. Its IUPAC name is N-[(Z,2E)-5-fluoro-2-propylidenehex-3-enyl]-1-methylpiperidin-4-amine.
| Compound Name | N-[(Z,2E)-5-fluoro-2-propylidenehex-3-enyl]-1-methylpiperidin-4-amine |
|---|---|
| PubChem CID | 143209317 |
| Molecular Formula | C15H27FN2 |
| Molecular Weight | 254.39 g/mol |
| Exact Mass | 254.22 |
| IUPAC Name | N-[(Z,2E)-5-fluoro-2-propylidenehex-3-enyl]-1-methylpiperidin-4-amine |
| SMILES | CC/C=C(\C=C/C(C)F)CNC1CCN(C)CC1 |
| InChI | InChI=1S/C15H27FN2/c1-4-5-14(7-6-13(2)16)12-17-15-8-10-18(3)11-9-15/h5-7,13,15,17H,4,8-12H2,1-3H3/b7-6-,14-5+ |
| InChIKey | QAVUGCRBFJFRDT-WFRORPSUSA-N |
| XLogP | 2.92 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.39 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|