C13H22F2N2 — CID 137467745
1-[(3E)-3-ethyl-2,2-difluorohexa-3,5-dienyl]piperidin-4-amine (PubChem CID 137467745) has the molecular formula C13H22F2N2 and a molecular weight of 244.33 g/mol. Its IUPAC name is 1-[(3E)-3-ethyl-2,2-difluorohexa-3,5-dienyl]piperidin-4-amine.
| Compound Name | 1-[(3E)-3-ethyl-2,2-difluorohexa-3,5-dienyl]piperidin-4-amine |
|---|---|
| PubChem CID | 137467745 |
| Molecular Formula | C13H22F2N2 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.18 |
| IUPAC Name | 1-[(3E)-3-ethyl-2,2-difluorohexa-3,5-dienyl]piperidin-4-amine |
| SMILES | C=C/C=C(\CC)C(F)(F)CN1CCC(N)CC1 |
| InChI | InChI=1S/C13H22F2N2/c1-3-5-11(4-2)13(14,15)10-17-8-6-12(16)7-9-17/h3,5,12H,1,4,6-10,16H2,2H3/b11-5+ |
| InChIKey | PZXRREJPXYCFSD-VZUCSPMQSA-N |
| XLogP | 2.57 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|