C18H35N3 — CID 142042010
(2Z)-2-(aminomethylidene)-6-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-1-methylpiperidin-3-amine;ethane (PubChem CID 142042010) has the molecular formula C18H35N3 and a molecular weight of 293.50 g/mol. Its IUPAC name is (2Z)-2-(aminomethylidene)-6-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-1-methylpiperidin-3-amine;ethane.
| Compound Name | (2Z)-2-(aminomethylidene)-6-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-1-methylpiperidin-3-amine;ethane |
|---|---|
| PubChem CID | 142042010 |
| Molecular Formula | C18H35N3 |
| Molecular Weight | 293.50 g/mol |
| Exact Mass | 293.28 |
| IUPAC Name | (2Z)-2-(aminomethylidene)-6-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-1-methylpiperidin-3-amine;ethane |
| SMILES | C=C/C=C(\C=C/C)C1CCC(N)/C(=C/N)N1C.CC.CC |
| InChI | InChI=1S/C14H23N3.2C2H6/c1-4-6-11(7-5-2)13-9-8-12(16)14(10-15)17(13)3;2*1-2/h4-7,10,12-13H,1,8-9,15-16H2,2-3H3;2*1-2H3/b7-5-,11-6+,14-10-;; |
| InChIKey | PPNOZBURRYRICN-MGXMOBGWSA-N |
| XLogP | 3.95 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.50 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|