C18H28FN3 — CID 153380018
(7Z,9E)-9-fluoro-1,2,12-trimethyl-8-(1,2,3,6-tetrahydropyridin-4-yl)-1,4-diazacyclododeca-5,7,9-triene (PubChem CID 153380018) has the molecular formula C18H28FN3 and a molecular weight of 305.44 g/mol. Its IUPAC name is (7Z,9E)-9-fluoro-1,2,12-trimethyl-8-(1,2,3,6-tetrahydropyridin-4-yl)-1,4-diazacyclododeca-5,7,9-triene.
| Compound Name | (7Z,9E)-9-fluoro-1,2,12-trimethyl-8-(1,2,3,6-tetrahydropyridin-4-yl)-1,4-diazacyclododeca-5,7,9-triene |
|---|---|
| PubChem CID | 153380018 |
| Molecular Formula | C18H28FN3 |
| Molecular Weight | 305.44 g/mol |
| Exact Mass | 305.23 |
| IUPAC Name | (7Z,9E)-9-fluoro-1,2,12-trimethyl-8-(1,2,3,6-tetrahydropyridin-4-yl)-1,4-diazacyclododeca-5,7,9-triene |
| SMILES | CC1C/C=C(F)\C(C2=CCNCC2)=C/C=CNCC(C)N1C |
| InChI | InChI=1S/C18H28FN3/c1-14-6-7-18(19)17(16-8-11-20-12-9-16)5-4-10-21-13-15(2)22(14)3/h4-5,7-8,10,14-15,20-21H,6,9,11-13H2,1-3H3/b10-4?,17-5-,18-7+ |
| InChIKey | QVEPNJGOOYDTMU-UNJRHNAQSA-N |
| XLogP | 2.90 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.44 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |