C30H47FN6 — CID 143567328
(2Z,4Z,6E,7Z)-4-(2,3-dihydropyrrol-1-yl)-6-ethylidene-9-fluoro-5-(methylideneamino)-1-methyliminoundeca-2,4,7,10-tetraen-3-amine;1-(4-methylpent-1-en-2-yl)piperidin-3-amine (PubChem CID 143567328) has the molecular formula C30H47FN6 and a molecular weight of 510.75 g/mol. Its IUPAC name is (2Z,4Z,6E,7Z)-4-(2,3-dihydropyrrol-1-yl)-6-ethylidene-9-fluoro-5-(methylideneamino)-1-methyliminoundeca-2,4,7,10-tetraen-3-amine;1-(4-methylpent-1-en-2-yl)piperidin-3-amine.
| Compound Name | (2Z,4Z,6E,7Z)-4-(2,3-dihydropyrrol-1-yl)-6-ethylidene-9-fluoro-5-(methylideneamino)-1-methyliminoundeca-2,4,7,10-tetraen-3-amine;1-(4-methylpent-1-en-2-yl)piperidin-3-amine |
|---|---|
| PubChem CID | 143567328 |
| Molecular Formula | C30H47FN6 |
| Molecular Weight | 510.75 g/mol |
| Exact Mass | 510.38 |
| IUPAC Name | (2Z,4Z,6E,7Z)-4-(2,3-dihydropyrrol-1-yl)-6-ethylidene-9-fluoro-5-(methylideneamino)-1-methyliminoundeca-2,4,7,10-tetraen-3-amine;1-(4-methylpent-1-en-2-yl)piperidin-3-amine |
| SMILES | C=C(CC(C)C)N1CCCC(N)C1.C=CC(F)/C=C\C(=C/C)\C(N=C)=C(C(/N)=C/C=N/C)\N1C=CCC1 |
| InChI | InChI=1S/C19H25FN4.C11H22N2/c1-5-15(9-10-16(20)6-2)18(23-4)19(17(21)11-12-22-3)24-13-7-8-14-24;1-9(2)7-10(3)13-6-4-5-11(12)8-13/h5-7,9-13,16H,2,4,8,14,21H2,1,3H3;9,11H,3-8,12H2,1-2H3/b10-9-,15-5+,17-11-,19-18-,22-12+; |
| InChIKey | IOAPAYYFCUAMLP-CYSJKPCZSA-N |
| XLogP | 5.66 |
| TPSA | 83.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.75 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|