C23H37FN4 — CID 130390370
(3Z,5Z)-2-[(5E)-5-butylidene-3-(N-ethenyl-C-methylcarbonimidoyl)-2H-pyrrol-1-yl]-9-fluoro-5,8-dimethylnona-3,5-diene-3,6-diamine (PubChem CID 130390370) has the molecular formula C23H37FN4 and a molecular weight of 388.58 g/mol. Its IUPAC name is (3Z,5Z)-2-[(5E)-5-butylidene-3-(N-ethenyl-C-methylcarbonimidoyl)-2H-pyrrol-1-yl]-9-fluoro-5,8-dimethylnona-3,5-diene-3,6-diamine.
| Compound Name | (3Z,5Z)-2-[(5E)-5-butylidene-3-(N-ethenyl-C-methylcarbonimidoyl)-2H-pyrrol-1-yl]-9-fluoro-5,8-dimethylnona-3,5-diene-3,6-diamine |
|---|---|
| PubChem CID | 130390370 |
| Molecular Formula | C23H37FN4 |
| Molecular Weight | 388.58 g/mol |
| Exact Mass | 388.30 |
| IUPAC Name | (3Z,5Z)-2-[(5E)-5-butylidene-3-(N-ethenyl-C-methylcarbonimidoyl)-2H-pyrrol-1-yl]-9-fluoro-5,8-dimethylnona-3,5-diene-3,6-diamine |
| SMILES | C=C/N=C(\C)C1=C/C(=C\CCC)N(C(C)/C(N)=C/C(C)=C(\N)CC(C)CF)C1 |
| InChI | InChI=1S/C23H37FN4/c1-7-9-10-21-13-20(18(5)27-8-2)15-28(21)19(6)23(26)12-17(4)22(25)11-16(3)14-24/h8,10,12-13,16,19H,2,7,9,11,14-15,25-26H2,1,3-6H3/b21-10+,22-17-,23-12-,27-18+ |
| InChIKey | MVUQHRCDVRZSMP-CWKLNYECSA-N |
| XLogP | 4.98 |
| TPSA | 67.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.58 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|