C22H34N4 — CID 144637554
2-N-ethenyl-3-N-[(2Z,4E)-1-methylimino-4-[(Z)-3-piperidin-4-ylprop-1-enyl]hepta-2,4-dien-3-yl]butane-2,3-diimine (PubChem CID 144637554) has the molecular formula C22H34N4 and a molecular weight of 354.54 g/mol. Its IUPAC name is 2-N-ethenyl-3-N-[(2Z,4E)-1-methylimino-4-[(Z)-3-piperidin-4-ylprop-1-enyl]hepta-2,4-dien-3-yl]butane-2,3-diimine.
| Compound Name | 2-N-ethenyl-3-N-[(2Z,4E)-1-methylimino-4-[(Z)-3-piperidin-4-ylprop-1-enyl]hepta-2,4-dien-3-yl]butane-2,3-diimine |
|---|---|
| PubChem CID | 144637554 |
| Molecular Formula | C22H34N4 |
| Molecular Weight | 354.54 g/mol |
| Exact Mass | 354.28 |
| IUPAC Name | 2-N-ethenyl-3-N-[(2Z,4E)-1-methylimino-4-[(Z)-3-piperidin-4-ylprop-1-enyl]hepta-2,4-dien-3-yl]butane-2,3-diimine |
| SMILES | C=C/N=C(C)/C(C)=N/C(=C\C=N\C)C(/C=C\CC1CCNCC1)=C/CC |
| InChI | InChI=1S/C22H34N4/c1-6-9-21(11-8-10-20-12-16-24-17-13-20)22(14-15-23-5)26-19(4)18(3)25-7-2/h7-9,11,14-15,20,24H,2,6,10,12-13,16-17H2,1,3-5H3/b11-8-,21-9+,22-14-,23-15+,25-18+,26-19+ |
| InChIKey | DTMRADRPSSYUKR-GZLWYJHQSA-N |
| XLogP | 4.92 |
| TPSA | 49.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.54 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|