C20H37N3 — CID 142954218
1-(1,3-dimethyl-2H-pyridin-2-yl)-N-methylmethanamine;ethane;N-(4-methylhexa-3,5-dien-2-yl)ethanimine (PubChem CID 142954218) has the molecular formula C20H37N3 and a molecular weight of 319.54 g/mol. Its IUPAC name is 1-(1,3-dimethyl-2H-pyridin-2-yl)-N-methylmethanamine;ethane;N-(4-methylhexa-3,5-dien-2-yl)ethanimine.
| Compound Name | 1-(1,3-dimethyl-2H-pyridin-2-yl)-N-methylmethanamine;ethane;N-(4-methylhexa-3,5-dien-2-yl)ethanimine |
|---|---|
| PubChem CID | 142954218 |
| Molecular Formula | C20H37N3 |
| Molecular Weight | 319.54 g/mol |
| Exact Mass | 319.30 |
| IUPAC Name | 1-(1,3-dimethyl-2H-pyridin-2-yl)-N-methylmethanamine;ethane;N-(4-methylhexa-3,5-dien-2-yl)ethanimine |
| SMILES | C=CC(C)=CC(C)/N=C/C.CC.CNCC1C(C)=CC=CN1C |
| InChI | InChI=1S/C9H16N2.C9H15N.C2H6/c1-8-5-4-6-11(3)9(8)7-10-2;1-5-8(3)7-9(4)10-6-2;1-2/h4-6,9-10H,7H2,1-3H3;5-7,9H,1H2,2-4H3;1-2H3/b;8-7?,10-6+; |
| InChIKey | GOPOVUFOZCDOOL-BAUZEFRXSA-N |
| XLogP | 4.60 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.54 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|