C28H41N5 — CID 142416788
(5Z,7Z)-9-[[5-(4-methylpiperazin-1-yl)-2,3,4,7-tetrahydro-1H-cyclohepta[c]pyridin-3-yl]methyl]-4,9-diazabicyclo[6.4.2]tetradeca-3,5,7-triene (PubChem CID 142416788) has the molecular formula C28H41N5 and a molecular weight of 447.67 g/mol. Its IUPAC name is (5Z,7Z)-9-[[5-(4-methylpiperazin-1-yl)-2,3,4,7-tetrahydro-1H-cyclohepta[c]pyridin-3-yl]methyl]-4,9-diazabicyclo[6.4.2]tetradeca-3,5,7-triene.
| Compound Name | (5Z,7Z)-9-[[5-(4-methylpiperazin-1-yl)-2,3,4,7-tetrahydro-1H-cyclohepta[c]pyridin-3-yl]methyl]-4,9-diazabicyclo[6.4.2]tetradeca-3,5,7-triene |
|---|---|
| PubChem CID | 142416788 |
| Molecular Formula | C28H41N5 |
| Molecular Weight | 447.67 g/mol |
| Exact Mass | 447.34 |
| IUPAC Name | (5Z,7Z)-9-[[5-(4-methylpiperazin-1-yl)-2,3,4,7-tetrahydro-1H-cyclohepta[c]pyridin-3-yl]methyl]-4,9-diazabicyclo[6.4.2]tetradeca-3,5,7-triene |
| SMILES | CN1CCN(C2=CCC=CC3=C2CC(CN2CCCC4C/C=N\C=C/C=C/2CC4)NC3)CC1 |
| InChI | InChI=1S/C28H41N5/c1-31-16-18-32(19-17-31)28-9-3-2-7-24-21-30-25(20-27(24)28)22-33-15-5-6-23-10-11-26(33)8-4-13-29-14-12-23/h2,4,7-9,13-14,23,25,30H,3,5-6,10-12,15-22H2,1H3/b13-4-,26-8+,29-14- |
| InChIKey | UXYFIESKVVBKHE-ULZVVQDISA-N |
| XLogP | 4.10 |
| TPSA | 34.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.67 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |