C20H34F2N4 — CID 143722045
N-[3-[(2E,4Z,6Z)-1-(dipropylamino)-3-methylocta-2,4,6-trien-2-yl]iminobut-1-en-2-yl]-N',N'-difluoromethanediamine (PubChem CID 143722045) has the molecular formula C20H34F2N4 and a molecular weight of 368.52 g/mol. Its IUPAC name is N-[3-[(2E,4Z,6Z)-1-(dipropylamino)-3-methylocta-2,4,6-trien-2-yl]iminobut-1-en-2-yl]-N',N'-difluoromethanediamine.
| Compound Name | N-[3-[(2E,4Z,6Z)-1-(dipropylamino)-3-methylocta-2,4,6-trien-2-yl]iminobut-1-en-2-yl]-N',N'-difluoromethanediamine |
|---|---|
| PubChem CID | 143722045 |
| Molecular Formula | C20H34F2N4 |
| Molecular Weight | 368.52 g/mol |
| Exact Mass | 368.28 |
| IUPAC Name | N-[3-[(2E,4Z,6Z)-1-(dipropylamino)-3-methylocta-2,4,6-trien-2-yl]iminobut-1-en-2-yl]-N',N'-difluoromethanediamine |
| SMILES | C=C(NCN(F)F)/C(C)=N/C(CN(CCC)CCC)=C(C)/C=C\C=C/C |
| InChI | InChI=1S/C20H34F2N4/c1-7-10-11-12-17(4)20(15-25(13-8-2)14-9-3)24-19(6)18(5)23-16-26(21)22/h7,10-12,23H,5,8-9,13-16H2,1-4,6H3/b10-7-,12-11-,20-17+,24-19+ |
| InChIKey | JFXQGNRGDQUPFF-WWXGEFLDSA-N |
| XLogP | 5.11 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.52 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|