C23H42F2N4O — CID 143722044
N-[3-[(2E,4Z,6Z)-1-(dipropylamino)-3-methylocta-2,4,6-trien-2-yl]iminobut-1-en-2-yl]-N',N'-difluoromethanediamine;propan-1-ol (PubChem CID 143722044) has the molecular formula C23H42F2N4O and a molecular weight of 428.61 g/mol. Its IUPAC name is N-[3-[(2E,4Z,6Z)-1-(dipropylamino)-3-methylocta-2,4,6-trien-2-yl]iminobut-1-en-2-yl]-N',N'-difluoromethanediamine;propan-1-ol.
| Compound Name | N-[3-[(2E,4Z,6Z)-1-(dipropylamino)-3-methylocta-2,4,6-trien-2-yl]iminobut-1-en-2-yl]-N',N'-difluoromethanediamine;propan-1-ol |
|---|---|
| PubChem CID | 143722044 |
| Molecular Formula | C23H42F2N4O |
| Molecular Weight | 428.61 g/mol |
| Exact Mass | 428.33 |
| IUPAC Name | N-[3-[(2E,4Z,6Z)-1-(dipropylamino)-3-methylocta-2,4,6-trien-2-yl]iminobut-1-en-2-yl]-N',N'-difluoromethanediamine;propan-1-ol |
| SMILES | C=C(NCN(F)F)/C(C)=N/C(CN(CCC)CCC)=C(C)/C=C\C=C/C.CCCO |
| InChI | InChI=1S/C20H34F2N4.C3H8O/c1-7-10-11-12-17(4)20(15-25(13-8-2)14-9-3)24-19(6)18(5)23-16-26(21)22;1-2-3-4/h7,10-12,23H,5,8-9,13-16H2,1-4,6H3;4H,2-3H2,1H3/b10-7-,12-11-,20-17+,24-19+; |
| InChIKey | CTDJNDKTMBVXJA-CDNYOZOUSA-N |
| XLogP | 5.50 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.61 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|