C20H17N5 — CID 135433559
8,11,22,23,25-pentazapentacyclo[16.3.1.13,6.18,11.113,16]pentacosa-1(21),2,4,6,9,12,14,16(23),17,19-decaene (PubChem CID 135433559) has the molecular formula C20H17N5 and a molecular weight of 327.39 g/mol. Its IUPAC name is 8,11,22,23,25-pentazapentacyclo[16.3.1.13,6.18,11.113,16]pentacosa-1(21),2,4,6,9,12,14,16(23),17,19-decaene.
| Compound Name | 8,11,22,23,25-pentazapentacyclo[16.3.1.13,6.18,11.113,16]pentacosa-1(21),2,4,6,9,12,14,16(23),17,19-decaene |
|---|---|
| PubChem CID | 135433559 |
| Molecular Formula | C20H17N5 |
| Molecular Weight | 327.39 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | 8,11,22,23,25-pentazapentacyclo[16.3.1.13,6.18,11.113,16]pentacosa-1(21),2,4,6,9,12,14,16(23),17,19-decaene |
| SMILES | C1=C/C2=C/C3=N/C(=C\N4C=CN(/C=c5/cc/c([nH]5)=C\C(=C1)N2)C4)C=C3 |
| InChI | InChI=1S/C20H17N5/c1-2-15-10-17-4-6-19(22-17)12-24-8-9-25(14-24)13-20-7-5-18(23-20)11-16(3-1)21-15/h1-13,21-22H,14H2/b16-11-,17-10+,19-12-,20-13- |
| InChIKey | JULZLKPJMMNTQA-UTJIDWAWSA-N |
| XLogP | 1.37 |
| TPSA | 46.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.39 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |