C24H26N6O — CID 123458693
2-N-(4-methoxyphenyl)-4-N,6-N-bis(3-methylphenyl)-1,4-dihydro-1,3,5-triazine-2,4,6-triamine (PubChem CID 123458693) has the molecular formula C24H26N6O and a molecular weight of 414.51 g/mol. Its IUPAC name is 2-N-(4-methoxyphenyl)-4-N,6-N-bis(3-methylphenyl)-1,4-dihydro-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N-(4-methoxyphenyl)-4-N,6-N-bis(3-methylphenyl)-1,4-dihydro-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 123458693 |
| Molecular Formula | C24H26N6O |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.22 |
| IUPAC Name | 2-N-(4-methoxyphenyl)-4-N,6-N-bis(3-methylphenyl)-1,4-dihydro-1,3,5-triazine-2,4,6-triamine |
| SMILES | COc1ccc(NC2=NC(Nc3cccc(C)c3)N=C(Nc3cccc(C)c3)N2)cc1 |
| InChI | InChI=1S/C24H26N6O/c1-16-6-4-8-19(14-16)26-23-28-22(25-18-10-12-21(31-3)13-11-18)29-24(30-23)27-20-9-5-7-17(2)15-20/h4-15,23,26H,1-3H3,(H3,25,27,28,29,30) |
| InChIKey | SOVKAFJQZAQWCO-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 82.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |