C8H9F3N4O3S — CID 123458990
[2-acetamido-4-(trifluoromethyl)-1,3-thiazol-5-yl]methyl N-aminocarbamate (PubChem CID 123458990) has the molecular formula C8H9F3N4O3S and a molecular weight of 298.25 g/mol. Its IUPAC name is [2-acetamido-4-(trifluoromethyl)-1,3-thiazol-5-yl]methyl N-aminocarbamate.
| Compound Name | [2-acetamido-4-(trifluoromethyl)-1,3-thiazol-5-yl]methyl N-aminocarbamate |
|---|---|
| PubChem CID | 123458990 |
| Molecular Formula | C8H9F3N4O3S |
| Molecular Weight | 298.25 g/mol |
| Exact Mass | 298.03 |
| IUPAC Name | [2-acetamido-4-(trifluoromethyl)-1,3-thiazol-5-yl]methyl N-aminocarbamate |
| SMILES | CC(=O)Nc1nc(C(F)(F)F)c(COC(=O)NN)s1 |
| InChI | InChI=1S/C8H9F3N4O3S/c1-3(16)13-6-14-5(8(9,10)11)4(19-6)2-18-7(17)15-12/h2,12H2,1H3,(H,15,17)(H,13,14,16) |
| InChIKey | QGVHWIRPDJVYFG-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 106.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.25 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|