C20H29NO — CID 123460145
(3S,4aR,6aR,7aS,8Z,10aS,11aR,11bR)-8-(isocyanomethylidene)-7a-methyl-2,3,4,4a,5,6,6a,7,9,10,10a,11,11a,11b-tetradecahydro-1H-cyclopenta[b]phenanthren-3-ol (PubChem CID 123460145) has the molecular formula C20H29NO and a molecular weight of 299.46 g/mol. Its IUPAC name is (3S,4aR,6aR,7aS,8Z,10aS,11aR,11bR)-8-(isocyanomethylidene)-7a-methyl-2,3,4,4a,5,6,6a,7,9,10,10a,11,11a,11b-tetradecahydro-1H-cyclopenta[b]phenanthren-3-ol.
| Compound Name | (3S,4aR,6aR,7aS,8Z,10aS,11aR,11bR)-8-(isocyanomethylidene)-7a-methyl-2,3,4,4a,5,6,6a,7,9,10,10a,11,11a,11b-tetradecahydro-1H-cyclopenta[b]phenanthren-3-ol |
|---|---|
| PubChem CID | 123460145 |
| Molecular Formula | C20H29NO |
| Molecular Weight | 299.46 g/mol |
| Exact Mass | 299.22 |
| IUPAC Name | (3S,4aR,6aR,7aS,8Z,10aS,11aR,11bR)-8-(isocyanomethylidene)-7a-methyl-2,3,4,4a,5,6,6a,7,9,10,10a,11,11a,11b-tetradecahydro-1H-cyclopenta[b]phenanthren-3-ol |
| SMILES | [C-]#[N+]/C=C1/CC[C@H]2C[C@@H]3[C@H](CC[C@@H]4C[C@@H](O)CC[C@H]43)C[C@]12C |
| InChI | InChI=1S/C20H29NO/c1-20-11-14-4-3-13-9-17(22)7-8-18(13)19(14)10-15(20)5-6-16(20)12-21-2/h12-15,17-19,22H,3-11H2,1H3/b16-12-/t13-,14-,15+,17+,18-,19-,20+/m1/s1 |
| InChIKey | RBWKRJZZDRODDO-TXXGXHFSSA-N |
| XLogP | 4.80 |
| TPSA | 24.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.46 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|