C12H16N2O4S2 — CID 123461040
3-[benzenesulfonyl(methoxy)amino]sulfanyl-N-methylbut-3-enamide (PubChem CID 123461040) has the molecular formula C12H16N2O4S2 and a molecular weight of 316.40 g/mol. Its IUPAC name is 3-[benzenesulfonyl(methoxy)amino]sulfanyl-N-methylbut-3-enamide.
| Compound Name | 3-[benzenesulfonyl(methoxy)amino]sulfanyl-N-methylbut-3-enamide |
|---|---|
| PubChem CID | 123461040 |
| Molecular Formula | C12H16N2O4S2 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.06 |
| IUPAC Name | 3-[benzenesulfonyl(methoxy)amino]sulfanyl-N-methylbut-3-enamide |
| SMILES | C=C(CC(=O)NC)SN(OC)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C12H16N2O4S2/c1-10(9-12(15)13-2)19-14(18-3)20(16,17)11-7-5-4-6-8-11/h4-8H,1,9H2,2-3H3,(H,13,15) |
| InChIKey | OXXUUCMGCYUMGF-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|