C20H42N2O2 — CID 123461277
2-amino-2-(16-amino-8-methylidenehexadecyl)propane-1,3-diol (PubChem CID 123461277) has the molecular formula C20H42N2O2 and a molecular weight of 342.57 g/mol. Its IUPAC name is 2-amino-2-(16-amino-8-methylidenehexadecyl)propane-1,3-diol.
| Compound Name | 2-amino-2-(16-amino-8-methylidenehexadecyl)propane-1,3-diol |
|---|---|
| PubChem CID | 123461277 |
| Molecular Formula | C20H42N2O2 |
| Molecular Weight | 342.57 g/mol |
| Exact Mass | 342.32 |
| IUPAC Name | 2-amino-2-(16-amino-8-methylidenehexadecyl)propane-1,3-diol |
| SMILES | C=C(CCCCCCCCN)CCCCCCCC(N)(CO)CO |
| InChI | InChI=1S/C20H42N2O2/c1-19(13-9-5-2-3-8-12-16-21)14-10-6-4-7-11-15-20(22,17-23)18-24/h23-24H,1-18,21-22H2 |
| InChIKey | YZBHTVYUZJXFSH-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.57 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|