C13H19NO — CID 123461500
2-(7-methoxy-3,4,8,8a-tetrahydronaphthalen-1-yl)ethanamine (PubChem CID 123461500) has the molecular formula C13H19NO and a molecular weight of 205.30 g/mol. Its IUPAC name is 2-(7-methoxy-3,4,8,8a-tetrahydronaphthalen-1-yl)ethanamine.
| Compound Name | 2-(7-methoxy-3,4,8,8a-tetrahydronaphthalen-1-yl)ethanamine |
|---|---|
| PubChem CID | 123461500 |
| Molecular Formula | C13H19NO |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.15 |
| IUPAC Name | 2-(7-methoxy-3,4,8,8a-tetrahydronaphthalen-1-yl)ethanamine |
| SMILES | COC1=CC=C2CCC=C(CCN)C2C1 |
| InChI | InChI=1S/C13H19NO/c1-15-12-6-5-10-3-2-4-11(7-8-14)13(10)9-12/h4-6,13H,2-3,7-9,14H2,1H3 |
| InChIKey | TWRGUNQDLOSWTP-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|