C11H19NO — CID 142229938
4-(4-methoxycyclohexa-1,3-dien-1-yl)butan-1-amine (PubChem CID 142229938) has the molecular formula C11H19NO and a molecular weight of 181.28 g/mol. Its IUPAC name is 4-(4-methoxycyclohexa-1,3-dien-1-yl)butan-1-amine.
| Compound Name | 4-(4-methoxycyclohexa-1,3-dien-1-yl)butan-1-amine |
|---|---|
| PubChem CID | 142229938 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | 4-(4-methoxycyclohexa-1,3-dien-1-yl)butan-1-amine |
| SMILES | COC1=CC=C(CCCCN)CC1 |
| InChI | InChI=1S/C11H19NO/c1-13-11-7-5-10(6-8-11)4-2-3-9-12/h5,7H,2-4,6,8-9,12H2,1H3 |
| InChIKey | LNAOGHMWLJQTRL-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|