C22H40O3 — CID 123463265
[2-bicyclo[2.2.1]heptanyl(2,2-dimethylpropoxy)methyl] 2,2,4,4-tetramethylpentanoate (PubChem CID 123463265) has the molecular formula C22H40O3 and a molecular weight of 352.56 g/mol. Its IUPAC name is [2-bicyclo[2.2.1]heptanyl(2,2-dimethylpropoxy)methyl] 2,2,4,4-tetramethylpentanoate.
| Compound Name | [2-bicyclo[2.2.1]heptanyl(2,2-dimethylpropoxy)methyl] 2,2,4,4-tetramethylpentanoate |
|---|---|
| PubChem CID | 123463265 |
| Molecular Formula | C22H40O3 |
| Molecular Weight | 352.56 g/mol |
| Exact Mass | 352.30 |
| IUPAC Name | [2-bicyclo[2.2.1]heptanyl(2,2-dimethylpropoxy)methyl] 2,2,4,4-tetramethylpentanoate |
| SMILES | CC(C)(C)COC(OC(=O)C(C)(C)CC(C)(C)C)C1CC2CCC1C2 |
| InChI | InChI=1S/C22H40O3/c1-20(2,3)13-22(7,8)19(23)25-18(24-14-21(4,5)6)17-12-15-9-10-16(17)11-15/h15-18H,9-14H2,1-8H3 |
| InChIKey | LJZJDIAEPASUTD-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.56 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|