C25H40O4 — CID 22665372
bis[1-(2-bicyclo[2.2.2]octanyl)ethyl] 2,2-dimethylpropanedioate (PubChem CID 22665372) has the molecular formula C25H40O4 and a molecular weight of 404.59 g/mol. Its IUPAC name is bis[1-(2-bicyclo[2.2.2]octanyl)ethyl] 2,2-dimethylpropanedioate.
| Compound Name | bis[1-(2-bicyclo[2.2.2]octanyl)ethyl] 2,2-dimethylpropanedioate |
|---|---|
| PubChem CID | 22665372 |
| Molecular Formula | C25H40O4 |
| Molecular Weight | 404.59 g/mol |
| Exact Mass | 404.29 |
| IUPAC Name | bis[1-(2-bicyclo[2.2.2]octanyl)ethyl] 2,2-dimethylpropanedioate |
| SMILES | CC(OC(=O)C(C)(C)C(=O)OC(C)C1CC2CCC1CC2)C1CC2CCC1CC2 |
| InChI | InChI=1S/C25H40O4/c1-15(21-13-17-5-9-19(21)10-6-17)28-23(26)25(3,4)24(27)29-16(2)22-14-18-7-11-20(22)12-8-18/h15-22H,5-14H2,1-4H3 |
| InChIKey | NVABUWRBBXMRIJ-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.59 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|