C18H12N2O8 — CID 123464325
4-(3-acetyl-2,4-dinitrophenyl)-7-methoxychromen-2-one (PubChem CID 123464325) has the molecular formula C18H12N2O8 and a molecular weight of 384.30 g/mol. Its IUPAC name is 4-(3-acetyl-2,4-dinitrophenyl)-7-methoxychromen-2-one.
| Compound Name | 4-(3-acetyl-2,4-dinitrophenyl)-7-methoxychromen-2-one |
|---|---|
| PubChem CID | 123464325 |
| Molecular Formula | C18H12N2O8 |
| Molecular Weight | 384.30 g/mol |
| Exact Mass | 384.06 |
| IUPAC Name | 4-(3-acetyl-2,4-dinitrophenyl)-7-methoxychromen-2-one |
| SMILES | COc1ccc2c(-c3ccc([N+](=O)[O-])c(C(C)=O)c3[N+](=O)[O-])cc(=O)oc2c1 |
| InChI | InChI=1S/C18H12N2O8/c1-9(21)17-14(19(23)24)6-5-12(18(17)20(25)26)13-8-16(22)28-15-7-10(27-2)3-4-11(13)15/h3-8H,1-2H3 |
| InChIKey | LYPODPNPWZBUAN-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 142.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.30 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|