C25H24N6O — CID 123465507
11-[2-(4-ethylcyclohepta-1,3,6-trien-1-yl)ethylamino]-8-phenyl-3,4,8,10,12-pentazatricyclo[7.4.0.02,6]trideca-1(13),2(6),4,9,11-pentaen-7-one (PubChem CID 123465507) has the molecular formula C25H24N6O and a molecular weight of 424.51 g/mol. Its IUPAC name is 11-[2-(4-ethylcyclohepta-1,3,6-trien-1-yl)ethylamino]-8-phenyl-3,4,8,10,12-pentazatricyclo[7.4.0.02,6]trideca-1(13),2(6),4,9,11-pentaen-7-one.
| Compound Name | 11-[2-(4-ethylcyclohepta-1,3,6-trien-1-yl)ethylamino]-8-phenyl-3,4,8,10,12-pentazatricyclo[7.4.0.02,6]trideca-1(13),2(6),4,9,11-pentaen-7-one |
|---|---|
| PubChem CID | 123465507 |
| Molecular Formula | C25H24N6O |
| Molecular Weight | 424.51 g/mol |
| Exact Mass | 424.20 |
| IUPAC Name | 11-[2-(4-ethylcyclohepta-1,3,6-trien-1-yl)ethylamino]-8-phenyl-3,4,8,10,12-pentazatricyclo[7.4.0.02,6]trideca-1(13),2(6),4,9,11-pentaen-7-one |
| SMILES | CCC1=CC=C(CCNc2ncc3c4[nH]ncc4c(=O)n(-c4ccccc4)c3n2)C=CC1 |
| InChI | InChI=1S/C25H24N6O/c1-2-17-7-6-8-18(12-11-17)13-14-26-25-27-15-20-22-21(16-28-30-22)24(32)31(23(20)29-25)19-9-4-3-5-10-19/h3-6,8-12,15-16H,2,7,13-14H2,1H3,(H,28,30)(H,26,27,29) |
| InChIKey | JHXYNVRSIYTBGT-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 88.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.51 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |