C10H15NO4 — CID 123466592
dimethyl 2-(C,N-dimethylcarbonimidoyl)pent-2-enedioate (PubChem CID 123466592) has the molecular formula C10H15NO4 and a molecular weight of 213.23 g/mol. Its IUPAC name is dimethyl 2-(C,N-dimethylcarbonimidoyl)pent-2-enedioate.
| Compound Name | dimethyl 2-(C,N-dimethylcarbonimidoyl)pent-2-enedioate |
|---|---|
| PubChem CID | 123466592 |
| Molecular Formula | C10H15NO4 |
| Molecular Weight | 213.23 g/mol |
| Exact Mass | 213.10 |
| IUPAC Name | dimethyl 2-(C,N-dimethylcarbonimidoyl)pent-2-enedioate |
| SMILES | C/N=C(\C)C(=CCC(=O)OC)C(=O)OC |
| InChI | InChI=1S/C10H15NO4/c1-7(11-2)8(10(13)15-4)5-6-9(12)14-3/h5H,6H2,1-4H3/b8-5?,11-7+ |
| InChIKey | LRWFNSVRNRIGEB-QZLZKBLMSA-N |
| XLogP | 0.74 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.23 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|