C9H13NO2 — CID 123289253
methyl 2-(C,N-dimethylcarbonimidoyl)penta-2,4-dienoate (PubChem CID 123289253) has the molecular formula C9H13NO2 and a molecular weight of 167.21 g/mol. Its IUPAC name is methyl 2-(C,N-dimethylcarbonimidoyl)penta-2,4-dienoate.
| Compound Name | methyl 2-(C,N-dimethylcarbonimidoyl)penta-2,4-dienoate |
|---|---|
| PubChem CID | 123289253 |
| Molecular Formula | C9H13NO2 |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.09 |
| IUPAC Name | methyl 2-(C,N-dimethylcarbonimidoyl)penta-2,4-dienoate |
| SMILES | C=CC=C(C(=O)OC)/C(C)=N/C |
| InChI | InChI=1S/C9H13NO2/c1-5-6-8(7(2)10-3)9(11)12-4/h5-6H,1H2,2-4H3/b8-6?,10-7+ |
| InChIKey | RIZGDIIJYWWUGR-UROOIGCASA-N |
| XLogP | 1.36 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|