C10H10N2O2 — CID 123899149
methyl 2,3-dihydroquinoxaline-6-carboxylate (PubChem CID 123899149) has the molecular formula C10H10N2O2 and a molecular weight of 190.20 g/mol. Its IUPAC name is methyl 2,3-dihydroquinoxaline-6-carboxylate.
| Compound Name | methyl 2,3-dihydroquinoxaline-6-carboxylate |
|---|---|
| PubChem CID | 123899149 |
| Molecular Formula | C10H10N2O2 |
| Molecular Weight | 190.20 g/mol |
| Exact Mass | 190.07 |
| IUPAC Name | methyl 2,3-dihydroquinoxaline-6-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)=NCCN=2 |
| InChI | InChI=1S/C10H10N2O2/c1-14-10(13)7-2-3-8-9(6-7)12-5-4-11-8/h2-3,6H,4-5H2,1H3 |
| InChIKey | LEHXBYHAQNGFLH-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.20 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |