C10H9FN2O2 — CID 163796855
methyl 3-fluoro-2,3-dihydroquinoxaline-6-carboxylate (PubChem CID 163796855) has the molecular formula C10H9FN2O2 and a molecular weight of 208.19 g/mol. Its IUPAC name is methyl 3-fluoro-2,3-dihydroquinoxaline-6-carboxylate.
| Compound Name | methyl 3-fluoro-2,3-dihydroquinoxaline-6-carboxylate |
|---|---|
| PubChem CID | 163796855 |
| Molecular Formula | C10H9FN2O2 |
| Molecular Weight | 208.19 g/mol |
| Exact Mass | 208.06 |
| IUPAC Name | methyl 3-fluoro-2,3-dihydroquinoxaline-6-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)=NC(F)CN=2 |
| InChI | InChI=1S/C10H9FN2O2/c1-15-10(14)6-2-3-7-8(4-6)13-9(11)5-12-7/h2-4,9H,5H2,1H3 |
| InChIKey | NBOAHKBLJSCTHX-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.19 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|