C11H13NO2 — CID 70456587
prop-2-enyl 4-methyliminocyclohexa-1,5-diene-1-carboxylate (PubChem CID 70456587) has the molecular formula C11H13NO2 and a molecular weight of 191.23 g/mol. Its IUPAC name is prop-2-enyl 4-methyliminocyclohexa-1,5-diene-1-carboxylate.
| Compound Name | prop-2-enyl 4-methyliminocyclohexa-1,5-diene-1-carboxylate |
|---|---|
| PubChem CID | 70456587 |
| Molecular Formula | C11H13NO2 |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.09 |
| IUPAC Name | prop-2-enyl 4-methyliminocyclohexa-1,5-diene-1-carboxylate |
| SMILES | C=CCOC(=O)C1=CC/C(=N\C)C=C1 |
| InChI | InChI=1S/C11H13NO2/c1-3-8-14-11(13)9-4-6-10(12-2)7-5-9/h3-6H,1,7-8H2,2H3/b12-10- |
| InChIKey | SPFBKAMFOLSUFU-BENRWUELSA-N |
| XLogP | 1.67 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|