C8H8N2O2 — CID 90098303
methyl 4-diazocyclohexa-1,5-diene-1-carboxylate (PubChem CID 90098303) has the molecular formula C8H8N2O2 and a molecular weight of 164.16 g/mol. Its IUPAC name is methyl 4-diazocyclohexa-1,5-diene-1-carboxylate.
| Compound Name | methyl 4-diazocyclohexa-1,5-diene-1-carboxylate |
|---|---|
| PubChem CID | 90098303 |
| Molecular Formula | C8H8N2O2 |
| Molecular Weight | 164.16 g/mol |
| Exact Mass | 164.06 |
| IUPAC Name | methyl 4-diazocyclohexa-1,5-diene-1-carboxylate |
| SMILES | COC(=O)C1=CCC(=[N+]=[N-])C=C1 |
| InChI | InChI=1S/C8H8N2O2/c1-12-8(11)6-2-4-7(10-9)5-3-6/h2-4H,5H2,1H3 |
| InChIKey | BUCQCBXZHMSVDQ-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 62.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.16 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|