C10H10FNO2 — CID 144524458
methyl (4E)-4-ethylidene-5-fluoro-3-iminocyclohexa-1,5-diene-1-carboxylate (PubChem CID 144524458) has the molecular formula C10H10FNO2 and a molecular weight of 195.19 g/mol. Its IUPAC name is methyl (4E)-4-ethylidene-5-fluoro-3-iminocyclohexa-1,5-diene-1-carboxylate.
| Compound Name | methyl (4E)-4-ethylidene-5-fluoro-3-iminocyclohexa-1,5-diene-1-carboxylate |
|---|---|
| PubChem CID | 144524458 |
| Molecular Formula | C10H10FNO2 |
| Molecular Weight | 195.19 g/mol |
| Exact Mass | 195.07 |
| IUPAC Name | methyl (4E)-4-ethylidene-5-fluoro-3-iminocyclohexa-1,5-diene-1-carboxylate |
| SMILES | [H]/N=C1\C=C(C(=O)OC)C=C(F)\C1=C\C |
| InChI | InChI=1S/C10H10FNO2/c1-3-7-8(11)4-6(5-9(7)12)10(13)14-2/h3-5,12H,1-2H3/b7-3-,12-9+ |
| InChIKey | KUBDFLGZQORSST-NBNYHDEESA-N |
| XLogP | 1.92 |
| TPSA | 50.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.19 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|