C38H52FNO4 — CID 123467332
[(3aR,5aS,5bR,9S,11aR)-3a-[(4-fluorophenyl)carbamoyl]-5a,5b,8,8,11a-pentamethyl-2-oxo-1-propan-2-yl-3,4,5,6,7,7a,9,10,11,11b,12,13-dodecahydro-1H-cyclopenta[a]chrysen-9-yl] acetate (PubChem CID 123467332) has the molecular formula C38H52FNO4 and a molecular weight of 605.84 g/mol. Its IUPAC name is [(3aR,5aS,5bR,9S,11aR)-3a-[(4-fluorophenyl)carbamoyl]-5a,5b,8,8,11a-pentamethyl-2-oxo-1-propan-2-yl-3,4,5,6,7,7a,9,10,11,11b,12,13-dodecahydro-1H-cyclopenta[a]chrysen-9-yl] acetate.
| Compound Name | [(3aR,5aS,5bR,9S,11aR)-3a-[(4-fluorophenyl)carbamoyl]-5a,5b,8,8,11a-pentamethyl-2-oxo-1-propan-2-yl-3,4,5,6,7,7a,9,10,11,11b,12,13-dodecahydro-1H-cyclopenta[a]chrysen-9-yl] acetate |
|---|---|
| PubChem CID | 123467332 |
| Molecular Formula | C38H52FNO4 |
| Molecular Weight | 605.84 g/mol |
| Exact Mass | 605.39 |
| IUPAC Name | [(3aR,5aS,5bR,9S,11aR)-3a-[(4-fluorophenyl)carbamoyl]-5a,5b,8,8,11a-pentamethyl-2-oxo-1-propan-2-yl-3,4,5,6,7,7a,9,10,11,11b,12,13-dodecahydro-1H-cyclopenta[a]chrysen-9-yl] acetate |
| SMILES | CC(=O)O[C@H]1CC[C@@]2(C)C(CC[C@]3(C)C2CCC2=C4C(C(C)C)C(=O)C[C@]4(C(=O)Nc4ccc(F)cc4)CC[C@]23C)C1(C)C |
| InChI | InChI=1S/C38H52FNO4/c1-22(2)31-27(42)21-38(33(43)40-25-11-9-24(39)10-12-25)20-19-36(7)26(32(31)38)13-14-29-35(6)17-16-30(44-23(3)41)34(4,5)28(35)15-18-37(29,36)8/h9-12,22,28-31H,13-21H2,1-8H3,(H,40,43)/t28?,29?,30-,31?,35-,36+,37+,38+/m0/s1 |
| InChIKey | YPZPNSISFWYYPZ-FLPZGFHZSA-N |
| XLogP | 8.68 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.84 |
| LogP ≤ 5 | 8.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|