C37H59NO4 — CID 123746089
[(3aR,5aS,5bR,9S,11aR)-3a-[tert-butyl(methyl)carbamoyl]-5a,5b,8,8,11a-pentamethyl-2-oxo-1-propan-2-yl-3,4,5,6,7,7a,9,10,11,11b,12,13-dodecahydro-1H-cyclopenta[a]chrysen-9-yl] acetate (PubChem CID 123746089) has the molecular formula C37H59NO4 and a molecular weight of 581.88 g/mol. Its IUPAC name is [(3aR,5aS,5bR,9S,11aR)-3a-[tert-butyl(methyl)carbamoyl]-5a,5b,8,8,11a-pentamethyl-2-oxo-1-propan-2-yl-3,4,5,6,7,7a,9,10,11,11b,12,13-dodecahydro-1H-cyclopenta[a]chrysen-9-yl] acetate.
| Compound Name | [(3aR,5aS,5bR,9S,11aR)-3a-[tert-butyl(methyl)carbamoyl]-5a,5b,8,8,11a-pentamethyl-2-oxo-1-propan-2-yl-3,4,5,6,7,7a,9,10,11,11b,12,13-dodecahydro-1H-cyclopenta[a]chrysen-9-yl] acetate |
|---|---|
| PubChem CID | 123746089 |
| Molecular Formula | C37H59NO4 |
| Molecular Weight | 581.88 g/mol |
| Exact Mass | 581.44 |
| IUPAC Name | [(3aR,5aS,5bR,9S,11aR)-3a-[tert-butyl(methyl)carbamoyl]-5a,5b,8,8,11a-pentamethyl-2-oxo-1-propan-2-yl-3,4,5,6,7,7a,9,10,11,11b,12,13-dodecahydro-1H-cyclopenta[a]chrysen-9-yl] acetate |
| SMILES | CC(=O)O[C@H]1CC[C@@]2(C)C(CC[C@]3(C)C2CCC2=C4C(C(C)C)C(=O)C[C@]4(C(=O)N(C)C(C)(C)C)CC[C@]23C)C1(C)C |
| InChI | InChI=1S/C37H59NO4/c1-22(2)29-25(40)21-37(31(41)38(12)32(4,5)6)20-19-35(10)24(30(29)37)13-14-27-34(9)17-16-28(42-23(3)39)33(7,8)26(34)15-18-36(27,35)11/h22,26-29H,13-21H2,1-12H3/t26?,27?,28-,29?,34-,35+,36+,37+/m0/s1 |
| InChIKey | RUIWHAVRGDKMFG-XNDCQKTHSA-N |
| XLogP | 8.16 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.88 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|