C18H20O4S2 — CID 123467751
1-(4,5-dimethylthieno[3,2-g][1]benzothiol-2-yl)-4-hydroxy-3,3-dimethoxybutan-1-one (PubChem CID 123467751) has the molecular formula C18H20O4S2 and a molecular weight of 364.49 g/mol. Its IUPAC name is 1-(4,5-dimethylthieno[3,2-g][1]benzothiol-2-yl)-4-hydroxy-3,3-dimethoxybutan-1-one.
| Compound Name | 1-(4,5-dimethylthieno[3,2-g][1]benzothiol-2-yl)-4-hydroxy-3,3-dimethoxybutan-1-one |
|---|---|
| PubChem CID | 123467751 |
| Molecular Formula | C18H20O4S2 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.08 |
| IUPAC Name | 1-(4,5-dimethylthieno[3,2-g][1]benzothiol-2-yl)-4-hydroxy-3,3-dimethoxybutan-1-one |
| SMILES | COC(CO)(CC(=O)c1cc2c(C)c(C)c3ccsc3c2s1)OC |
| InChI | InChI=1S/C18H20O4S2/c1-10-11(2)13-7-15(14(20)8-18(9-19,21-3)22-4)24-17(13)16-12(10)5-6-23-16/h5-7,19H,8-9H2,1-4H3 |
| InChIKey | HKXMVILKAFTQSK-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|