C20H19F3O2S2 — CID 123984100
1-(4,5-dipropylthieno[3,2-g][1]benzothiol-2-yl)-4,4,4-trifluorobutane-1,3-dione (PubChem CID 123984100) has the molecular formula C20H19F3O2S2 and a molecular weight of 412.50 g/mol. Its IUPAC name is 1-(4,5-dipropylthieno[3,2-g][1]benzothiol-2-yl)-4,4,4-trifluorobutane-1,3-dione.
| Compound Name | 1-(4,5-dipropylthieno[3,2-g][1]benzothiol-2-yl)-4,4,4-trifluorobutane-1,3-dione |
|---|---|
| PubChem CID | 123984100 |
| Molecular Formula | C20H19F3O2S2 |
| Molecular Weight | 412.50 g/mol |
| Exact Mass | 412.08 |
| IUPAC Name | 1-(4,5-dipropylthieno[3,2-g][1]benzothiol-2-yl)-4,4,4-trifluorobutane-1,3-dione |
| SMILES | CCCc1c(CCC)c2cc(C(=O)CC(=O)C(F)(F)F)sc2c2sccc12 |
| InChI | InChI=1S/C20H19F3O2S2/c1-3-5-11-12(6-4-2)14-9-16(15(24)10-17(25)20(21,22)23)27-19(14)18-13(11)7-8-26-18/h7-9H,3-6,10H2,1-2H3 |
| InChIKey | BCSYGCOIZRRCDR-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.50 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|