C37H34F6O7S — CID 162189057
1,3-bis(2,4,6-trimethylphenyl)propane-1,3-dione;4,4,4-trifluoro-1-(furan-2-yl)butane-1,3-dione;4,4,4-trifluoro-1-thiophen-2-ylbutane-1,3-dione (PubChem CID 162189057) has the molecular formula C37H34F6O7S and a molecular weight of 736.73 g/mol. Its IUPAC name is 1,3-bis(2,4,6-trimethylphenyl)propane-1,3-dione;4,4,4-trifluoro-1-(furan-2-yl)butane-1,3-dione;4,4,4-trifluoro-1-thiophen-2-ylbutane-1,3-dione.
| Compound Name | 1,3-bis(2,4,6-trimethylphenyl)propane-1,3-dione;4,4,4-trifluoro-1-(furan-2-yl)butane-1,3-dione;4,4,4-trifluoro-1-thiophen-2-ylbutane-1,3-dione |
|---|---|
| PubChem CID | 162189057 |
| Molecular Formula | C37H34F6O7S |
| Molecular Weight | 736.73 g/mol |
| Exact Mass | 736.19 |
| IUPAC Name | 1,3-bis(2,4,6-trimethylphenyl)propane-1,3-dione;4,4,4-trifluoro-1-(furan-2-yl)butane-1,3-dione;4,4,4-trifluoro-1-thiophen-2-ylbutane-1,3-dione |
| SMILES | Cc1cc(C)c(C(=O)CC(=O)c2c(C)cc(C)cc2C)c(C)c1.O=C(CC(=O)C(F)(F)F)c1ccco1.O=C(CC(=O)C(F)(F)F)c1cccs1 |
| InChI | InChI=1S/C21H24O2.C8H5F3O3.C8H5F3O2S/c1-12-7-14(3)20(15(4)8-12)18(22)11-19(23)21-16(5)9-13(2)10-17(21)6;2*9-8(10,11)7(13)4-5(12)6-2-1-3-14-6/h7-10H,11H2,1-6H3;2*1-3H,4H2 |
| InChIKey | ZQBAGIGDTNXWPR-UHFFFAOYSA-N |
| XLogP | 9.43 |
| TPSA | 115.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 736.73 |
| LogP ≤ 5 | 9.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|