C20H19F3O2 — CID 20503209
1-[4-(4-butylphenyl)phenyl]-4,4,4-trifluorobutane-1,3-dione (PubChem CID 20503209) has the molecular formula C20H19F3O2 and a molecular weight of 348.36 g/mol. Its IUPAC name is 1-[4-(4-butylphenyl)phenyl]-4,4,4-trifluorobutane-1,3-dione.
| Compound Name | 1-[4-(4-butylphenyl)phenyl]-4,4,4-trifluorobutane-1,3-dione |
|---|---|
| PubChem CID | 20503209 |
| Molecular Formula | C20H19F3O2 |
| Molecular Weight | 348.36 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | 1-[4-(4-butylphenyl)phenyl]-4,4,4-trifluorobutane-1,3-dione |
| SMILES | CCCCc1ccc(-c2ccc(C(=O)CC(=O)C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C20H19F3O2/c1-2-3-4-14-5-7-15(8-6-14)16-9-11-17(12-10-16)18(24)13-19(25)20(21,22)23/h5-12H,2-4,13H2,1H3 |
| InChIKey | YBSPRTGOYYGMNE-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.36 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|