C29H30FNO4 — CID 123468097
tert-butyl 7-[2-cycloprop-2-en-1-yl-4-(4-fluorophenyl)quinolin-3-yl]-3,5-dihydroxyhept-6-enoate (PubChem CID 123468097) has the molecular formula C29H30FNO4 and a molecular weight of 475.56 g/mol. Its IUPAC name is tert-butyl 7-[2-cycloprop-2-en-1-yl-4-(4-fluorophenyl)quinolin-3-yl]-3,5-dihydroxyhept-6-enoate.
| Compound Name | tert-butyl 7-[2-cycloprop-2-en-1-yl-4-(4-fluorophenyl)quinolin-3-yl]-3,5-dihydroxyhept-6-enoate |
|---|---|
| PubChem CID | 123468097 |
| Molecular Formula | C29H30FNO4 |
| Molecular Weight | 475.56 g/mol |
| Exact Mass | 475.22 |
| IUPAC Name | tert-butyl 7-[2-cycloprop-2-en-1-yl-4-(4-fluorophenyl)quinolin-3-yl]-3,5-dihydroxyhept-6-enoate |
| SMILES | CC(C)(C)OC(=O)CC(O)CC(O)C=Cc1c(C2C=C2)nc2ccccc2c1-c1ccc(F)cc1 |
| InChI | InChI=1S/C29H30FNO4/c1-29(2,3)35-26(34)17-22(33)16-21(32)14-15-24-27(18-10-12-20(30)13-11-18)23-6-4-5-7-25(23)31-28(24)19-8-9-19/h4-15,19,21-22,32-33H,16-17H2,1-3H3 |
| InChIKey | GHYWNIAUYDAQOE-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 79.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.56 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|