C24H25F2NO4 — CID 123468148
tert-butyl 3-[4-[2-[(2,6-difluorobenzoyl)amino]-2-methylpropanoyl]phenyl]prop-2-enoate (PubChem CID 123468148) has the molecular formula C24H25F2NO4 and a molecular weight of 429.46 g/mol. Its IUPAC name is tert-butyl 3-[4-[2-[(2,6-difluorobenzoyl)amino]-2-methylpropanoyl]phenyl]prop-2-enoate.
| Compound Name | tert-butyl 3-[4-[2-[(2,6-difluorobenzoyl)amino]-2-methylpropanoyl]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 123468148 |
| Molecular Formula | C24H25F2NO4 |
| Molecular Weight | 429.46 g/mol |
| Exact Mass | 429.18 |
| IUPAC Name | tert-butyl 3-[4-[2-[(2,6-difluorobenzoyl)amino]-2-methylpropanoyl]phenyl]prop-2-enoate |
| SMILES | CC(C)(C)OC(=O)C=Cc1ccc(C(=O)C(C)(C)NC(=O)c2c(F)cccc2F)cc1 |
| InChI | InChI=1S/C24H25F2NO4/c1-23(2,3)31-19(28)14-11-15-9-12-16(13-10-15)21(29)24(4,5)27-22(30)20-17(25)7-6-8-18(20)26/h6-14H,1-5H3,(H,27,30) |
| InChIKey | IPMYDPWPMCFEMD-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.46 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|