C23H24F3NO3 — CID 134947200
tert-butyl N-[(E,2R)-1,1,1-trifluoro-2-(4-methylphenyl)-3-oxo-5-phenylpent-4-en-2-yl]carbamate (PubChem CID 134947200) has the molecular formula C23H24F3NO3 and a molecular weight of 419.44 g/mol. Its IUPAC name is tert-butyl N-[(E,2R)-1,1,1-trifluoro-2-(4-methylphenyl)-3-oxo-5-phenylpent-4-en-2-yl]carbamate.
| Compound Name | tert-butyl N-[(E,2R)-1,1,1-trifluoro-2-(4-methylphenyl)-3-oxo-5-phenylpent-4-en-2-yl]carbamate |
|---|---|
| PubChem CID | 134947200 |
| Molecular Formula | C23H24F3NO3 |
| Molecular Weight | 419.44 g/mol |
| Exact Mass | 419.17 |
| IUPAC Name | tert-butyl N-[(E,2R)-1,1,1-trifluoro-2-(4-methylphenyl)-3-oxo-5-phenylpent-4-en-2-yl]carbamate |
| SMILES | Cc1ccc([C@@](NC(=O)OC(C)(C)C)(C(=O)/C=C/c2ccccc2)C(F)(F)F)cc1 |
| InChI | InChI=1S/C23H24F3NO3/c1-16-10-13-18(14-11-16)22(23(24,25)26,27-20(29)30-21(2,3)4)19(28)15-12-17-8-6-5-7-9-17/h5-15H,1-4H3,(H,27,29)/b15-12+/t22-/m1/s1 |
| InChIKey | YHISGXRVLUSFRX-OWSFEGEDSA-N |
| XLogP | 5.56 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.44 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|