C21H27NO3S — CID 11303314
tert-butyl N-[(2S)-1-[(R)-(4-methylphenyl)sulfinyl]-2-phenylpropan-2-yl]carbamate (PubChem CID 11303314) has the molecular formula C21H27NO3S and a molecular weight of 373.52 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-[(R)-(4-methylphenyl)sulfinyl]-2-phenylpropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-[(R)-(4-methylphenyl)sulfinyl]-2-phenylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 11303314 |
| Molecular Formula | C21H27NO3S |
| Molecular Weight | 373.52 g/mol |
| Exact Mass | 373.17 |
| IUPAC Name | tert-butyl N-[(2S)-1-[(R)-(4-methylphenyl)sulfinyl]-2-phenylpropan-2-yl]carbamate |
| SMILES | Cc1ccc([S@](=O)C[C@@](C)(NC(=O)OC(C)(C)C)c2ccccc2)cc1 |
| InChI | InChI=1S/C21H27NO3S/c1-16-11-13-18(14-12-16)26(24)15-21(5,17-9-7-6-8-10-17)22-19(23)25-20(2,3)4/h6-14H,15H2,1-5H3,(H,22,23)/t21-,26-/m1/s1 |
| InChIKey | OYVVZTOFVXHCOX-QFQXNSOFSA-N |
| XLogP | 4.54 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.52 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |