About 4,5-dimethylidene-1,3-thiazole-2-carbonitrile
4,5-dimethylidene-1,3-thiazole-2-carbonitrile (PubChem CID 123469250) has the molecular formula C6H4N2S
and a molecular weight of 136.18 g/mol. Its IUPAC name is 4,5-dimethylidene-1,3-thiazole-2-carbonitrile.
Molecular Properties
| Compound Name | 4,5-dimethylidene-1,3-thiazole-2-carbonitrile |
| PubChem CID | 123469250 |
| Molecular Formula | C6H4N2S |
| Molecular Weight | 136.18 g/mol |
| Exact Mass | 136.01 |
| IUPAC Name | 4,5-dimethylidene-1,3-thiazole-2-carbonitrile |
| SMILES | C=c1nc(C#N)sc1=C |
| InChI | InChI=1S/C6H4N2S/c1-4-5(2)9-6(3-7)8-4/h1-2H2 |
| InChIKey | SFDKRLIMWZPROQ-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.18 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4,5-dimethylidene-1,3-thiazole-2-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dimethylidene-1,3-thiazole-2-carbonitrile?
The IUPAC name of 4,5-dimethylidene-1,3-thiazole-2-carbonitrile (CID 123469250) is 4,5-dimethylidene-1,3-thiazole-2-carbonitrile.
What is the SMILES notation for 4,5-dimethylidene-1,3-thiazole-2-carbonitrile?
The canonical SMILES for 4,5-dimethylidene-1,3-thiazole-2-carbonitrile is C=c1nc(C#N)sc1=C.
What is the InChIKey of 4,5-dimethylidene-1,3-thiazole-2-carbonitrile?
The InChIKey is SFDKRLIMWZPROQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4N2S/c1-4-5(2)9-6(3-7)8-4/h1-2H2.
What are the key properties of 4,5-dimethylidene-1,3-thiazole-2-carbonitrile?
4,5-dimethylidene-1,3-thiazole-2-carbonitrile has a molecular weight of 136.18 g/mol, XLogP of -0.16, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dimethylidene-1,3-thiazole-2-carbonitrile is sourced from PubChem (CID 123469250), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).