C6H7NS — CID 123462275
2-methyl-4,5-dimethylidene-1,3-thiazole (PubChem CID 123462275) has the molecular formula C6H7NS and a molecular weight of 125.20 g/mol. Its IUPAC name is 2-methyl-4,5-dimethylidene-1,3-thiazole.
| Compound Name | 2-methyl-4,5-dimethylidene-1,3-thiazole |
|---|---|
| PubChem CID | 123462275 |
| Molecular Formula | C6H7NS |
| Molecular Weight | 125.20 g/mol |
| Exact Mass | 125.03 |
| IUPAC Name | 2-methyl-4,5-dimethylidene-1,3-thiazole |
| SMILES | C=c1nc(C)sc1=C |
| InChI | InChI=1S/C6H7NS/c1-4-5(2)8-6(3)7-4/h1-2H2,3H3 |
| InChIKey | CYLDVJSJDCAZLE-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 125.20 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |