About 2,5-dimethyl-4-methylidene-1,3-thiazol-5-ide
2,5-dimethyl-4-methylidene-1,3-thiazol-5-ide (PubChem CID 91444485) has the molecular formula C6H8NS-
and a molecular weight of 126.20 g/mol. Its IUPAC name is 2,5-dimethyl-4-methylidene-1,3-thiazol-5-ide.
Molecular Properties
| Compound Name | 2,5-dimethyl-4-methylidene-1,3-thiazol-5-ide |
| PubChem CID | 91444485 |
| Molecular Formula | C6H8NS- |
| Molecular Weight | 126.20 g/mol |
| Exact Mass | 126.04 |
| IUPAC Name | 2,5-dimethyl-4-methylidene-1,3-thiazol-5-ide |
| SMILES | C=C1N=C(C)S[C-]1C |
| InChI | InChI=1S/C6H8NS/c1-4-5(2)8-6(3)7-4/h1H2,2-3H3/q-1 |
| InChIKey | IMKUOEKNKMRRIV-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.20 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 2,5-dimethyl-4-methylidene-1,3-thiazol-5-ide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dimethyl-4-methylidene-1,3-thiazol-5-ide?
The IUPAC name of 2,5-dimethyl-4-methylidene-1,3-thiazol-5-ide (CID 91444485) is 2,5-dimethyl-4-methylidene-1,3-thiazol-5-ide.
What is the SMILES notation for 2,5-dimethyl-4-methylidene-1,3-thiazol-5-ide?
The canonical SMILES for 2,5-dimethyl-4-methylidene-1,3-thiazol-5-ide is C=C1N=C(C)S[C-]1C.
What is the InChIKey of 2,5-dimethyl-4-methylidene-1,3-thiazol-5-ide?
The InChIKey is IMKUOEKNKMRRIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8NS/c1-4-5(2)8-6(3)7-4/h1H2,2-3H3/q-1.
What are the key properties of 2,5-dimethyl-4-methylidene-1,3-thiazol-5-ide?
2,5-dimethyl-4-methylidene-1,3-thiazol-5-ide has a molecular weight of 126.20 g/mol, XLogP of 2.22, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dimethyl-4-methylidene-1,3-thiazol-5-ide is sourced from PubChem (CID 91444485), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).