C13H21FN2O2 — CID 123469268
2-fluoro-N-(3-formamidocyclopentyl)hept-2-enamide (PubChem CID 123469268) has the molecular formula C13H21FN2O2 and a molecular weight of 256.32 g/mol. Its IUPAC name is 2-fluoro-N-(3-formamidocyclopentyl)hept-2-enamide.
| Compound Name | 2-fluoro-N-(3-formamidocyclopentyl)hept-2-enamide |
|---|---|
| PubChem CID | 123469268 |
| Molecular Formula | C13H21FN2O2 |
| Molecular Weight | 256.32 g/mol |
| Exact Mass | 256.16 |
| IUPAC Name | 2-fluoro-N-(3-formamidocyclopentyl)hept-2-enamide |
| SMILES | CCCCC=C(F)C(=O)NC1CCC(NC=O)C1 |
| InChI | InChI=1S/C13H21FN2O2/c1-2-3-4-5-12(14)13(18)16-11-7-6-10(8-11)15-9-17/h5,9-11H,2-4,6-8H2,1H3,(H,15,17)(H,16,18) |
| InChIKey | WSQLJPGHZPYVCL-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.32 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|