C40H60O7 — CID 123471558
(9-hexa-3,5-dien-2-yl-11-hydroxy-2,10,14,16,18,23,23-heptamethyl-7-oxo-8,22,24-trioxabicyclo[19.3.1]pentacosa-3,5,19-trien-17-yl) 2-methylbut-3-ynoate (PubChem CID 123471558) has the molecular formula C40H60O7 and a molecular weight of 652.91 g/mol. Its IUPAC name is (9-hexa-3,5-dien-2-yl-11-hydroxy-2,10,14,16,18,23,23-heptamethyl-7-oxo-8,22,24-trioxabicyclo[19.3.1]pentacosa-3,5,19-trien-17-yl) 2-methylbut-3-ynoate.
| Compound Name | (9-hexa-3,5-dien-2-yl-11-hydroxy-2,10,14,16,18,23,23-heptamethyl-7-oxo-8,22,24-trioxabicyclo[19.3.1]pentacosa-3,5,19-trien-17-yl) 2-methylbut-3-ynoate |
|---|---|
| PubChem CID | 123471558 |
| Molecular Formula | C40H60O7 |
| Molecular Weight | 652.91 g/mol |
| Exact Mass | 652.43 |
| IUPAC Name | (9-hexa-3,5-dien-2-yl-11-hydroxy-2,10,14,16,18,23,23-heptamethyl-7-oxo-8,22,24-trioxabicyclo[19.3.1]pentacosa-3,5,19-trien-17-yl) 2-methylbut-3-ynoate |
| SMILES | C#CC(C)C(=O)OC1C(C)C=CC2CC(OC(C)(C)O2)C(C)C=CC=CC(=O)OC(C(C)C=CC=C)C(C)C(O)CCC(C)CC1C |
| InChI | InChI=1S/C40H60O7/c1-12-14-17-29(6)38-32(9)34(41)23-20-26(3)24-31(8)37(45-39(43)27(4)13-2)30(7)21-22-33-25-35(47-40(10,11)46-33)28(5)18-15-16-19-36(42)44-38/h2,12,14-19,21-22,26-35,37-38,41H,1,20,23-25H2,3-11H3 |
| InChIKey | VJGDCVBKVYATHA-UHFFFAOYSA-N |
| XLogP | 7.76 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.91 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|