C19H19FN6O3 — CID 123471910
6-[(1-amino-1-hydroxypropan-2-yl)amino]-2-[2-(4-fluorophenoxy)-4-pyridinyl]pyrimidine-4-carboxamide (PubChem CID 123471910) has the molecular formula C19H19FN6O3 and a molecular weight of 398.40 g/mol. Its IUPAC name is 6-[(1-amino-1-hydroxypropan-2-yl)amino]-2-[2-(4-fluorophenoxy)-4-pyridinyl]pyrimidine-4-carboxamide.
| Compound Name | 6-[(1-amino-1-hydroxypropan-2-yl)amino]-2-[2-(4-fluorophenoxy)-4-pyridinyl]pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 123471910 |
| Molecular Formula | C19H19FN6O3 |
| Molecular Weight | 398.40 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | 6-[(1-amino-1-hydroxypropan-2-yl)amino]-2-[2-(4-fluorophenoxy)-4-pyridinyl]pyrimidine-4-carboxamide |
| SMILES | CC(Nc1cc(C(N)=O)nc(-c2ccnc(Oc3ccc(F)cc3)c2)n1)C(N)O |
| InChI | InChI=1S/C19H19FN6O3/c1-10(17(21)27)24-15-9-14(18(22)28)25-19(26-15)11-6-7-23-16(8-11)29-13-4-2-12(20)3-5-13/h2-10,17,27H,21H2,1H3,(H2,22,28)(H,24,25,26) |
| InChIKey | SDKRXBWUOPTGEV-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 149.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.40 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|