C19H17FN6O3 — CID 89422461
6-[(1-amino-3-oxopropan-2-yl)amino]-2-[2-(4-fluorophenoxy)-4-pyridinyl]pyrimidine-4-carboxamide (PubChem CID 89422461) has the molecular formula C19H17FN6O3 and a molecular weight of 396.38 g/mol. Its IUPAC name is 6-[(1-amino-3-oxopropan-2-yl)amino]-2-[2-(4-fluorophenoxy)-4-pyridinyl]pyrimidine-4-carboxamide.
| Compound Name | 6-[(1-amino-3-oxopropan-2-yl)amino]-2-[2-(4-fluorophenoxy)-4-pyridinyl]pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 89422461 |
| Molecular Formula | C19H17FN6O3 |
| Molecular Weight | 396.38 g/mol |
| Exact Mass | 396.13 |
| IUPAC Name | 6-[(1-amino-3-oxopropan-2-yl)amino]-2-[2-(4-fluorophenoxy)-4-pyridinyl]pyrimidine-4-carboxamide |
| SMILES | NCC(C=O)Nc1cc(C(N)=O)nc(-c2ccnc(Oc3ccc(F)cc3)c2)n1 |
| InChI | InChI=1S/C19H17FN6O3/c20-12-1-3-14(4-2-12)29-17-7-11(5-6-23-17)19-25-15(18(22)28)8-16(26-19)24-13(9-21)10-27/h1-8,10,13H,9,21H2,(H2,22,28)(H,24,25,26) |
| InChIKey | ONEMRQNRMAXSOK-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 146.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.38 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|