C18H22FN7O2 — CID 123338256
6-[[(2S)-1-amino-3-oxopropan-2-yl]amino]-2-[4-(4-fluorophenyl)piperazin-1-yl]pyrimidine-4-carboxamide (PubChem CID 123338256) has the molecular formula C18H22FN7O2 and a molecular weight of 387.42 g/mol. Its IUPAC name is 6-[[(2S)-1-amino-3-oxopropan-2-yl]amino]-2-[4-(4-fluorophenyl)piperazin-1-yl]pyrimidine-4-carboxamide.
| Compound Name | 6-[[(2S)-1-amino-3-oxopropan-2-yl]amino]-2-[4-(4-fluorophenyl)piperazin-1-yl]pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 123338256 |
| Molecular Formula | C18H22FN7O2 |
| Molecular Weight | 387.42 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | 6-[[(2S)-1-amino-3-oxopropan-2-yl]amino]-2-[4-(4-fluorophenyl)piperazin-1-yl]pyrimidine-4-carboxamide |
| SMILES | NC[C@@H](C=O)Nc1cc(C(N)=O)nc(N2CCN(c3ccc(F)cc3)CC2)n1 |
| InChI | InChI=1S/C18H22FN7O2/c19-12-1-3-14(4-2-12)25-5-7-26(8-6-25)18-23-15(17(21)28)9-16(24-18)22-13(10-20)11-27/h1-4,9,11,13H,5-8,10,20H2,(H2,21,28)(H,22,23,24)/t13-/m0/s1 |
| InChIKey | RTAUZYHJDVQWFJ-ZDUSSCGKSA-N |
| XLogP | -0.02 |
| TPSA | 130.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.42 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|