C19H18ClN7O3 — CID 89422696
6-[(1-amino-3-oxopropan-2-yl)amino]-2-[2-(2-amino-4-pyridinyl)-4-chlorophenoxy]pyrimidine-4-carboxamide (PubChem CID 89422696) has the molecular formula C19H18ClN7O3 and a molecular weight of 427.85 g/mol. Its IUPAC name is 6-[(1-amino-3-oxopropan-2-yl)amino]-2-[2-(2-amino-4-pyridinyl)-4-chlorophenoxy]pyrimidine-4-carboxamide.
| Compound Name | 6-[(1-amino-3-oxopropan-2-yl)amino]-2-[2-(2-amino-4-pyridinyl)-4-chlorophenoxy]pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 89422696 |
| Molecular Formula | C19H18ClN7O3 |
| Molecular Weight | 427.85 g/mol |
| Exact Mass | 427.12 |
| IUPAC Name | 6-[(1-amino-3-oxopropan-2-yl)amino]-2-[2-(2-amino-4-pyridinyl)-4-chlorophenoxy]pyrimidine-4-carboxamide |
| SMILES | NCC(C=O)Nc1cc(C(N)=O)nc(Oc2ccc(Cl)cc2-c2ccnc(N)c2)n1 |
| InChI | InChI=1S/C19H18ClN7O3/c20-11-1-2-15(13(6-11)10-3-4-24-16(22)5-10)30-19-26-14(18(23)29)7-17(27-19)25-12(8-21)9-28/h1-7,9,12H,8,21H2,(H2,22,24)(H2,23,29)(H,25,26,27) |
| InChIKey | HYWBTFSMTVEXMD-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 172.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.85 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|